C13H21ClN2O4S — CID 119975673
ethyl 4-[(1-amino-2-methylpropan-2-yl)sulfamoyl]benzoate;hydrochloride (PubChem CID 119975673) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is ethyl 4-[(1-amino-2-methylpropan-2-yl)sulfamoyl]benzoate;hydrochloride.
| Compound Name | ethyl 4-[(1-amino-2-methylpropan-2-yl)sulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119975673 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethyl 4-[(1-amino-2-methylpropan-2-yl)sulfamoyl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NC(C)(C)CN)cc1.Cl |
| InChI | InChI=1S/C13H20N2O4S.ClH/c1-4-19-12(16)10-5-7-11(8-6-10)20(17,18)15-13(2,3)9-14;/h5-8,15H,4,9,14H2,1-3H3;1H |
| InChIKey | SQHMIHLTZJMQJJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |