C14H20N2O6S — CID 8500965
ethyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoyl]benzoate (PubChem CID 8500965) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is ethyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8500965 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H20N2O6S/c1-5-21-12(17)10-6-8-11(9-7-10)23(19,20)16-15-13(18)22-14(2,3)4/h6-9,16H,5H2,1-4H3,(H,15,18) |
| InChIKey | FYOVLCXFXOYHNH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|