C20H26N2O5S — CID 4248662
ethyl 4-[(adamantane-1-carbonylamino)sulfamoyl]benzoate (PubChem CID 4248662) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is ethyl 4-[(adamantane-1-carbonylamino)sulfamoyl]benzoate.
| Compound Name | ethyl 4-[(adamantane-1-carbonylamino)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4248662 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | ethyl 4-[(adamantane-1-carbonylamino)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-2-27-18(23)16-3-5-17(6-4-16)28(25,26)22-21-19(24)20-10-13-7-14(11-20)9-15(8-13)12-20/h3-6,13-15,22H,2,7-12H2,1H3,(H,21,24) |
| InChIKey | JMNDNWZINSERCQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|