C14H19NO5S — CID 66005245
ethyl 4-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoate (PubChem CID 66005245) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is ethyl 4-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoate.
| Compound Name | ethyl 4-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 66005245 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 4-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCC2CC(O)C2)cc1 |
| InChI | InChI=1S/C14H19NO5S/c1-2-20-14(17)11-3-5-13(6-4-11)21(18,19)15-9-10-7-12(16)8-10/h3-6,10,12,15-16H,2,7-9H2,1H3 |
| InChIKey | YOUSXWXWUDBICD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |