C14H19NO6S2 — CID 52512736
ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]methylsulfamoyl]benzoate (PubChem CID 52512736) has the molecular formula C14H19NO6S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]methylsulfamoyl]benzoate.
| Compound Name | ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 52512736 |
| Molecular Formula | C14H19NO6S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]methylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NC[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19NO6S2/c1-2-21-14(16)12-3-5-13(6-4-12)23(19,20)15-9-11-7-8-22(17,18)10-11/h3-6,11,15H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | UNZNATNJTZQGPQ-LLVKDONJSA-N |
| XLogP | 0.58 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |