C13H17NO6S2 — CID 25035168
ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate (PubChem CID 25035168) has the molecular formula C13H17NO6S2 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate.
| Compound Name | ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25035168 |
| Molecular Formula | C13H17NO6S2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO6S2/c1-2-20-13(15)10-3-5-12(6-4-10)22(18,19)14-11-7-8-21(16,17)9-11/h3-6,11,14H,2,7-9H2,1H3 |
| InChIKey | ZNPWUHBNVAPZPX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |