C21H25NO7S2 — CID 42902905
2-(2,6-dimethylphenoxy)ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate (PubChem CID 42902905) has the molecular formula C21H25NO7S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate.
| Compound Name | 2-(2,6-dimethylphenoxy)ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42902905 |
| Molecular Formula | C21H25NO7S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)ethyl 4-[(1,1-dioxothiolan-3-yl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(C)c1OCCOC(=O)c1ccc(S(=O)(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H25NO7S2/c1-15-4-3-5-16(2)20(15)28-11-12-29-21(23)17-6-8-19(9-7-17)31(26,27)22-18-10-13-30(24,25)14-18/h3-9,18,22H,10-14H2,1-2H3 |
| InChIKey | HTEMUISBVGHBRO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|