C24H32N2O4S — CID 108565354
N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]-4-methylbenzenesulfonamide (PubChem CID 108565354) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 108565354 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCN(C(=O)CCCOc3c(C)cccc3C)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-18-9-11-22(12-10-18)31(28,29)25-21-13-15-26(16-14-21)23(27)8-5-17-30-24-19(2)6-4-7-20(24)3/h4,6-7,9-12,21,25H,5,8,13-17H2,1-3H3 |
| InChIKey | SMPKVBWGVMQLIX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|