C19H26Cl2N2O3 — CID 108565365
2,2-dichloro-N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]acetamide (PubChem CID 108565365) has the molecular formula C19H26Cl2N2O3 and a molecular weight of 401.33 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108565365 |
| Molecular Formula | C19H26Cl2N2O3 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2,2-dichloro-N-[1-[4-(2,6-dimethylphenoxy)butanoyl]piperidin-4-yl]acetamide |
| SMILES | Cc1cccc(C)c1OCCCC(=O)N1CCC(NC(=O)C(Cl)Cl)CC1 |
| InChI | InChI=1S/C19H26Cl2N2O3/c1-13-5-3-6-14(2)17(13)26-12-4-7-16(24)23-10-8-15(9-11-23)22-19(25)18(20)21/h3,5-6,15,18H,4,7-12H2,1-2H3,(H,22,25) |
| InChIKey | FDPOATXBZQARMC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|