C20H30N2O4 — CID 108536173
4-(2,6-dimethylphenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one (PubChem CID 108536173) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(2,6-dimethylphenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108536173 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one |
| SMILES | COCCC(=O)N1CCN(C(=O)CCCOc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C20H30N2O4/c1-16-6-4-7-17(2)20(16)26-14-5-8-18(23)21-10-12-22(13-11-21)19(24)9-15-25-3/h4,6-7H,5,8-15H2,1-3H3 |
| InChIKey | YARPTCAOINAFTG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|