C27H33N3O3 — CID 108764444
4-(2,6-dimethylphenoxy)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 108764444) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(2,6-dimethylphenoxy)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108764444 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-1-[4-(8-methoxy-4-methylquinolin-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | COc1cccc2c(C)cc(N3CCN(C(=O)CCCOc4c(C)cccc4C)CC3)nc12 |
| InChI | InChI=1S/C27H33N3O3/c1-19-8-5-9-20(2)27(19)33-17-7-12-25(31)30-15-13-29(14-16-30)24-18-21(3)22-10-6-11-23(32-4)26(22)28-24/h5-6,8-11,18H,7,12-17H2,1-4H3 |
| InChIKey | IVRPVQMWSGTNHW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|