C29H31N3O2 — CID 108754811
1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one (PubChem CID 108754811) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one.
| Compound Name | 1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one |
|---|---|
| PubChem CID | 108754811 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)CCCOc3ccc4ccccc4c3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C29H31N3O2/c1-21-7-5-10-26-22(2)19-27(30-29(21)26)31-14-16-32(17-15-31)28(33)11-6-18-34-25-13-12-23-8-3-4-9-24(23)20-25/h3-5,7-10,12-13,19-20H,6,11,14-18H2,1-2H3 |
| InChIKey | FQTGPUDEBJHZMY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|