C26H29N3O2 — CID 108754780
(E)-1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 108754780) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (E)-1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 108754780 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (E)-1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-3-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCN(c3cc(C)c4cccc(C)c4n3)CC2)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-4-31-22-11-8-21(9-12-22)10-13-25(30)29-16-14-28(15-17-29)24-18-20(3)23-7-5-6-19(2)26(23)27-24/h5-13,18H,4,14-17H2,1-3H3/b13-10+ |
| InChIKey | YBMJMNUIVIQTOR-JLHYYAGUSA-N |
| XLogP | 4.61 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|