C23H24N4O4 — CID 108731279
1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-2-(4-nitrophenoxy)ethanone (PubChem CID 108731279) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-2-(4-nitrophenoxy)ethanone.
| Compound Name | 1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-2-(4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 108731279 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]-2-(4-nitrophenoxy)ethanone |
| SMILES | Cc1cc(N2CCN(C(=O)COc3ccc([N+](=O)[O-])cc3)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C23H24N4O4/c1-16-4-3-5-20-17(2)14-21(24-23(16)20)25-10-12-26(13-11-25)22(28)15-31-19-8-6-18(7-9-19)27(29)30/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | NJNHZMRFHCOLGD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|