C18H14F5N3O4 — CID 3461803
2-(4-nitrophenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone (PubChem CID 3461803) has the molecular formula C18H14F5N3O4 and a molecular weight of 431.32 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-nitrophenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 3461803 |
| Molecular Formula | C18H14F5N3O4 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-(4-nitrophenoxy)-1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H14F5N3O4/c19-13-14(20)16(22)18(17(23)15(13)21)25-7-5-24(6-8-25)12(27)9-30-11-3-1-10(2-4-11)26(28)29/h1-4H,5-9H2 |
| InChIKey | QTCJTFJHDBCCID-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|