C19H23ClN4O4 — CID 52984340
2-(4-nitrophenoxy)-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 52984340) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-nitrophenoxy)-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 52984340 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-(4-nitrophenoxy)-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1ccc([N+](=O)[O-])cc1)N1CCN(CCc2ccncc2)CC1 |
| InChI | InChI=1S/C19H22N4O4.ClH/c24-19(15-27-18-3-1-17(2-4-18)23(25)26)22-13-11-21(12-14-22)10-7-16-5-8-20-9-6-16;/h1-6,8-9H,7,10-15H2;1H |
| InChIKey | WDRAXRGEXYRXLU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|