C21H25N7O2 — CID 71705465
2-[4-(2-methyltetrazol-5-yl)phenoxy]-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone (PubChem CID 71705465) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-[4-(2-methyltetrazol-5-yl)phenoxy]-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(2-methyltetrazol-5-yl)phenoxy]-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 71705465 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-[4-(2-methyltetrazol-5-yl)phenoxy]-1-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]ethanone |
| SMILES | Cn1nnc(-c2ccc(OCC(=O)N3CCN(CCc4ccncc4)CC3)cc2)n1 |
| InChI | InChI=1S/C21H25N7O2/c1-26-24-21(23-25-26)18-2-4-19(5-3-18)30-16-20(29)28-14-12-27(13-15-28)11-8-17-6-9-22-10-7-17/h2-7,9-10H,8,11-16H2,1H3 |
| InChIKey | FIOXNIALIWGGTH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |