C16H21N5O6 — CID 4739754
4-[4-[2-(4-nitrophenoxy)acetyl]piperazin-1-yl]-4-oxobutanehydrazide (PubChem CID 4739754) has the molecular formula C16H21N5O6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-[4-[2-(4-nitrophenoxy)acetyl]piperazin-1-yl]-4-oxobutanehydrazide.
| Compound Name | 4-[4-[2-(4-nitrophenoxy)acetyl]piperazin-1-yl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 4739754 |
| Molecular Formula | C16H21N5O6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-[4-[2-(4-nitrophenoxy)acetyl]piperazin-1-yl]-4-oxobutanehydrazide |
| SMILES | NNC(=O)CCC(=O)N1CCN(C(=O)COc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H21N5O6/c17-18-14(22)5-6-15(23)19-7-9-20(10-8-19)16(24)11-27-13-3-1-12(2-4-13)21(25)26/h1-4H,5-11,17H2,(H,18,22) |
| InChIKey | OTZFHHPLEIGPAR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|