C24H25ClF4N2O2 — CID 17310806
1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-2-(4-cyclohexylphenoxy)ethanone (PubChem CID 17310806) has the molecular formula C24H25ClF4N2O2 and a molecular weight of 484.92 g/mol. Its IUPAC name is 1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-2-(4-cyclohexylphenoxy)ethanone.
| Compound Name | 1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-2-(4-cyclohexylphenoxy)ethanone |
|---|---|
| PubChem CID | 17310806 |
| Molecular Formula | C24H25ClF4N2O2 |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]-2-(4-cyclohexylphenoxy)ethanone |
| SMILES | O=C(COc1ccc(C2CCCCC2)cc1)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C24H25ClF4N2O2/c25-19-20(26)22(28)24(23(29)21(19)27)31-12-10-30(11-13-31)18(32)14-33-17-8-6-16(7-9-17)15-4-2-1-3-5-15/h6-9,15H,1-5,10-14H2 |
| InChIKey | LIRIHSZLGCUSIE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|