C20H18Cl2F4N2O2 — CID 17018407
2-(4-chloro-3,5-dimethylphenoxy)-1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone (PubChem CID 17018407) has the molecular formula C20H18Cl2F4N2O2 and a molecular weight of 465.27 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17018407 |
| Molecular Formula | C20H18Cl2F4N2O2 |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-1-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(OCC(=O)N2CCN(c3c(F)c(F)c(Cl)c(F)c3F)CC2)cc(C)c1Cl |
| InChI | InChI=1S/C20H18Cl2F4N2O2/c1-10-7-12(8-11(2)14(10)21)30-9-13(29)27-3-5-28(6-4-27)20-18(25)16(23)15(22)17(24)19(20)26/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | XPSNZXLEJCULAJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|