C28H36ClN3O3 — CID 2944567
N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-2-(4-cyclohexylphenoxy)acetamide (PubChem CID 2944567) has the molecular formula C28H36ClN3O3 and a molecular weight of 498.07 g/mol. Its IUPAC name is N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-2-(4-cyclohexylphenoxy)acetamide.
| Compound Name | N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-2-(4-cyclohexylphenoxy)acetamide |
|---|---|
| PubChem CID | 2944567 |
| Molecular Formula | C28H36ClN3O3 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-2-(4-cyclohexylphenoxy)acetamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=O)COc3ccc(C4CCCCC4)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C28H36ClN3O3/c1-2-6-28(34)32-17-15-31(16-18-32)26-14-11-23(19-25(26)29)30-27(33)20-35-24-12-9-22(10-13-24)21-7-4-3-5-8-21/h9-14,19,21H,2-8,15-18,20H2,1H3,(H,30,33) |
| InChIKey | QCPQJRHAFYBFPS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|