C26H34ClN3O3 — CID 17092273
N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-tert-butylphenoxy)acetamide (PubChem CID 17092273) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-tert-butylphenoxy)acetamide.
| Compound Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-tert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 17092273 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-2-(4-tert-butylphenoxy)acetamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(Cl)cc2NC(=O)COc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H34ClN3O3/c1-5-6-25(32)30-15-13-29(14-16-30)23-12-9-20(27)17-22(23)28-24(31)18-33-21-10-7-19(8-11-21)26(2,3)4/h7-12,17H,5-6,13-16,18H2,1-4H3,(H,28,31) |
| InChIKey | URDYWWOACGBHJP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |