C20H29ClN4O2S — CID 17091965
N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-2,2-dimethylpropanamide (PubChem CID 17091965) has the molecular formula C20H29ClN4O2S and a molecular weight of 425.00 g/mol. Its IUPAC name is N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 17091965 |
| Molecular Formula | C20H29ClN4O2S |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-2,2-dimethylpropanamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(Cl)cc2NC(=S)NC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H29ClN4O2S/c1-5-6-17(26)25-11-9-24(10-12-25)16-8-7-14(21)13-15(16)22-19(28)23-18(27)20(2,3)4/h7-8,13H,5-6,9-12H2,1-4H3,(H2,22,23,27,28) |
| InChIKey | NVYFYMITTKHKKM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|