C22H24Cl2N4O2S — CID 17091928
N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-3-chlorobenzamide (PubChem CID 17091928) has the molecular formula C22H24Cl2N4O2S and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-3-chlorobenzamide.
| Compound Name | N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 17091928 |
| Molecular Formula | C22H24Cl2N4O2S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]carbamothioyl]-3-chlorobenzamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(Cl)cc2NC(=S)NC(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24Cl2N4O2S/c1-2-4-20(29)28-11-9-27(10-12-28)19-8-7-17(24)14-18(19)25-22(31)26-21(30)15-5-3-6-16(23)13-15/h3,5-8,13-14H,2,4,9-12H2,1H3,(H2,25,26,30,31) |
| InChIKey | KOGMMWHNMFFQST-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|