C28H29ClN4O3S — CID 3590129
N-[[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide (PubChem CID 3590129) has the molecular formula C28H29ClN4O3S and a molecular weight of 537.09 g/mol. Its IUPAC name is N-[[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 3590129 |
| Molecular Formula | C28H29ClN4O3S |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | N-[[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide |
| SMILES | CCC(=O)N1CCN(c2ccc(Cl)cc2NC(=S)NC(=O)c2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C28H29ClN4O3S/c1-2-26(34)33-15-13-32(14-16-33)25-12-11-22(29)18-24(25)30-28(37)31-27(35)21-9-6-10-23(17-21)36-19-20-7-4-3-5-8-20/h3-12,17-18H,2,13-16,19H2,1H3,(H2,30,31,35,37) |
| InChIKey | OOLJFEVAUOAVEB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|