C32H29ClN4O3S — CID 17317799
N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylmethoxybenzamide (PubChem CID 17317799) has the molecular formula C32H29ClN4O3S and a molecular weight of 585.13 g/mol. Its IUPAC name is N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17317799 |
| Molecular Formula | C32H29ClN4O3S |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-phenylmethoxybenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(Cl)c1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H29ClN4O3S/c33-28-21-26(14-15-29(28)36-16-18-37(19-17-36)31(39)24-10-5-2-6-11-24)34-32(41)35-30(38)25-12-7-13-27(20-25)40-22-23-8-3-1-4-9-23/h1-15,20-21H,16-19,22H2,(H2,34,35,38,41) |
| InChIKey | SFBRTEGPKWHCAI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|