C29H31ClN4O2S — CID 17317777
N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-4-tert-butylbenzamide (PubChem CID 17317777) has the molecular formula C29H31ClN4O2S and a molecular weight of 535.11 g/mol. Its IUPAC name is N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-4-tert-butylbenzamide.
| Compound Name | N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 17317777 |
| Molecular Formula | C29H31ClN4O2S |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | N-[[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4ccccc4)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C29H31ClN4O2S/c1-29(2,3)22-11-9-20(10-12-22)26(35)32-28(37)31-23-13-14-25(24(30)19-23)33-15-17-34(18-16-33)27(36)21-7-5-4-6-8-21/h4-14,19H,15-18H2,1-3H3,(H2,31,32,35,37) |
| InChIKey | KUCJBJPUJHTRFJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|