C31H34N4O4S — CID 17091865
methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate (PubChem CID 17091865) has the molecular formula C31H34N4O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17091865 |
| Molecular Formula | C31H34N4O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C31H34N4O4S/c1-31(2,3)24-13-10-21(11-14-24)27(36)33-30(40)32-25-20-23(29(38)39-4)12-15-26(25)34-16-18-35(19-17-34)28(37)22-8-6-5-7-9-22/h5-15,20H,16-19H2,1-4H3,(H2,32,33,36,40) |
| InChIKey | JLLBBDUHSDRULW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|