C27H25BrN4O4S — CID 17091869
methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2-bromobenzoyl)carbamothioylamino]benzoate (PubChem CID 17091869) has the molecular formula C27H25BrN4O4S and a molecular weight of 581.49 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2-bromobenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2-bromobenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17091869 |
| Molecular Formula | C27H25BrN4O4S |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[(2-bromobenzoyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=S)NC(=O)c2ccccc2Br)c1 |
| InChI | InChI=1S/C27H25BrN4O4S/c1-36-26(35)19-11-12-23(31-13-15-32(16-14-31)25(34)18-7-3-2-4-8-18)22(17-19)29-27(37)30-24(33)20-9-5-6-10-21(20)28/h2-12,17H,13-16H2,1H3,(H2,29,30,33,37) |
| InChIKey | AYTTXHYFGLLMJG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|