C22H25BrN4O4S — CID 17099087
methyl 3-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 17099087) has the molecular formula C22H25BrN4O4S and a molecular weight of 521.44 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | methyl 3-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 17099087 |
| Molecular Formula | C22H25BrN4O4S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | methyl 3-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C)CC2)c(NC(=S)NC(=O)c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C22H25BrN4O4S/c1-26-8-10-27(11-9-26)18-6-4-14(21(29)31-3)12-17(18)24-22(32)25-20(28)16-13-15(23)5-7-19(16)30-2/h4-7,12-13H,8-11H2,1-3H3,(H2,24,25,28,32) |
| InChIKey | ZYWYWAQNZKHHFP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|