C22H24Cl2N4O4S — CID 17335685
methyl 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 17335685) has the molecular formula C22H24Cl2N4O4S and a molecular weight of 511.43 g/mol. Its IUPAC name is methyl 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | methyl 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 17335685 |
| Molecular Formula | C22H24Cl2N4O4S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | methyl 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C)CC2)c(NC(=S)NC(=O)c2cc(Cl)c(OC)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H24Cl2N4O4S/c1-27-6-8-28(9-7-27)18-5-4-13(21(30)32-3)12-17(18)25-22(33)26-20(29)14-10-15(23)19(31-2)16(24)11-14/h4-5,10-12H,6-9H2,1-3H3,(H2,25,26,29,33) |
| InChIKey | QGSATBRTFYJRSF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|