C23H28N4O5S — CID 17313751
methyl 3-[(2,6-dimethoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 17313751) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is methyl 3-[(2,6-dimethoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | methyl 3-[(2,6-dimethoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 17313751 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | methyl 3-[(2,6-dimethoxybenzoyl)carbamothioylamino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C)CC2)c(NC(=S)NC(=O)c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C23H28N4O5S/c1-26-10-12-27(13-11-26)17-9-8-15(22(29)32-4)14-16(17)24-23(33)25-21(28)20-18(30-2)6-5-7-19(20)31-3/h5-9,14H,10-13H2,1-4H3,(H2,24,25,28,33) |
| InChIKey | YFPHHHIMKZTPRC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|