C20H22IN3O3 — CID 6457104
methyl 3-[(3-iodobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 6457104) has the molecular formula C20H22IN3O3 and a molecular weight of 479.32 g/mol. Its IUPAC name is methyl 3-[(3-iodobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | methyl 3-[(3-iodobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 6457104 |
| Molecular Formula | C20H22IN3O3 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | methyl 3-[(3-iodobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C)CC2)c(NC(=O)c2cccc(I)c2)c1 |
| InChI | InChI=1S/C20H22IN3O3/c1-23-8-10-24(11-9-23)18-7-6-15(20(26)27-2)13-17(18)22-19(25)14-4-3-5-16(21)12-14/h3-7,12-13H,8-11H2,1-2H3,(H,22,25) |
| InChIKey | SUTXVOOAMXRWSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|