C22H28N3O3+ — CID 7341186
methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(3-methylbenzoyl)amino]benzoate (PubChem CID 7341186) has the molecular formula C22H28N3O3+ and a molecular weight of 382.48 g/mol. Its IUPAC name is methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(3-methylbenzoyl)amino]benzoate.
| Compound Name | methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(3-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7341186 |
| Molecular Formula | C22H28N3O3+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(3-methylbenzoyl)amino]benzoate |
| SMILES | CC[NH+]1CCN(c2ccc(C(=O)OC)cc2NC(=O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-4-24-10-12-25(13-11-24)20-9-8-18(22(27)28-3)15-19(20)23-21(26)17-7-5-6-16(2)14-17/h5-9,14-15H,4,10-13H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | KOIMCHCADQFCGO-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |