C21H27ClN3O+ — CID 7535503
N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethylbenzamide (PubChem CID 7535503) has the molecular formula C21H27ClN3O+ and a molecular weight of 372.92 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethylbenzamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 7535503 |
| Molecular Formula | C21H27ClN3O+ |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethylbenzamide |
| SMILES | CC[NH+]1CCN(c2ccc(Cl)cc2NC(=O)c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C21H26ClN3O/c1-4-24-7-9-25(10-8-24)20-6-5-18(22)14-19(20)23-21(26)17-12-15(2)11-16(3)13-17/h5-6,11-14H,4,7-10H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | UDVHTGXGKRQXGT-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |