C21H27ClN3O3+ — CID 7491968
N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethoxybenzamide (PubChem CID 7491968) has the molecular formula C21H27ClN3O3+ and a molecular weight of 404.92 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 7491968 |
| Molecular Formula | C21H27ClN3O3+ |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3,5-dimethoxybenzamide |
| SMILES | CC[NH+]1CCN(c2ccc(Cl)cc2NC(=O)c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-4-24-7-9-25(10-8-24)20-6-5-16(22)13-19(20)23-21(26)15-11-17(27-2)14-18(12-15)28-3/h5-6,11-14H,4,7-10H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | ITIANAXWMLUBTR-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |