C21H25FN3O3+ — CID 7328895
methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(4-fluorobenzoyl)amino]benzoate (PubChem CID 7328895) has the molecular formula C21H25FN3O3+ and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(4-fluorobenzoyl)amino]benzoate.
| Compound Name | methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(4-fluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7328895 |
| Molecular Formula | C21H25FN3O3+ |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | methyl 4-(4-ethylpiperazin-4-ium-1-yl)-3-[(4-fluorobenzoyl)amino]benzoate |
| SMILES | CC[NH+]1CCN(c2ccc(C(=O)OC)cc2NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FN3O3/c1-3-24-10-12-25(13-11-24)19-9-6-16(21(27)28-2)14-18(19)23-20(26)15-4-7-17(22)8-5-15/h4-9,14H,3,10-13H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | MTCKRUZMGHBQKM-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |