C20H24Cl2N3O2+ — CID 7679043
3-chloro-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-4-methoxybenzamide (PubChem CID 7679043) has the molecular formula C20H24Cl2N3O2+ and a molecular weight of 409.34 g/mol. Its IUPAC name is 3-chloro-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-4-methoxybenzamide.
| Compound Name | 3-chloro-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7679043 |
| Molecular Formula | C20H24Cl2N3O2+ |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3-chloro-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-4-methoxybenzamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3ccc(OC)c(Cl)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-3-24-8-10-25(11-9-24)18-6-5-15(13-16(18)21)23-20(26)14-4-7-19(27-2)17(22)12-14/h4-7,12-13H,3,8-11H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | ARCRUCAGNZZSOU-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|