C23H31ClN3O2+ — CID 2067744
3-butoxy-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide (PubChem CID 2067744) has the molecular formula C23H31ClN3O2+ and a molecular weight of 416.97 g/mol. Its IUPAC name is 3-butoxy-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide.
| Compound Name | 3-butoxy-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 2067744 |
| Molecular Formula | C23H31ClN3O2+ |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-butoxy-N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc(N3CC[NH+](CC)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H30ClN3O2/c1-3-5-15-29-20-8-6-7-18(16-20)23(28)25-19-9-10-22(21(24)17-19)27-13-11-26(4-2)12-14-27/h6-10,16-17H,3-5,11-15H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | IMLFGXXOMAMMFX-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|