C15H23ClN3O+ — CID 6957202
N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]propanamide (PubChem CID 6957202) has the molecular formula C15H23ClN3O+ and a molecular weight of 296.82 g/mol. Its IUPAC name is N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]propanamide.
| Compound Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 6957202 |
| Molecular Formula | C15H23ClN3O+ |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2CC[NH+](CC)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClN3O/c1-3-15(20)17-12-5-6-14(13(16)11-12)19-9-7-18(4-2)8-10-19/h5-6,11H,3-4,7-10H2,1-2H3,(H,17,20)/p+1 |
| InChIKey | CQLBSBDWEVDLRE-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|