C19H22ClN4O3+ — CID 7553469
N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-nitrobenzamide (PubChem CID 7553469) has the molecular formula C19H22ClN4O3+ and a molecular weight of 389.86 g/mol. Its IUPAC name is N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-nitrobenzamide.
| Compound Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 7553469 |
| Molecular Formula | C19H22ClN4O3+ |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-nitrobenzamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3ccccc3[N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C19H21ClN4O3/c1-2-22-9-11-23(12-10-22)18-8-7-14(13-16(18)20)21-19(25)15-5-3-4-6-17(15)24(26)27/h3-8,13H,2,9-12H2,1H3,(H,21,25)/p+1 |
| InChIKey | ZFAMEJFHOOZAHI-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|