C19H19ClN4O3S — CID 1338454
N-[(3-chloro-4-piperidin-1-ylphenyl)carbamothioyl]-2-nitrobenzamide (PubChem CID 1338454) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is N-[(3-chloro-4-piperidin-1-ylphenyl)carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[(3-chloro-4-piperidin-1-ylphenyl)carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 1338454 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[(3-chloro-4-piperidin-1-ylphenyl)carbamothioyl]-2-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCCCC2)c(Cl)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClN4O3S/c20-15-12-13(8-9-17(15)23-10-4-1-5-11-23)21-19(28)22-18(25)14-6-2-3-7-16(14)24(26)27/h2-3,6-9,12H,1,4-5,10-11H2,(H2,21,22,25,28) |
| InChIKey | ZLUYTQSSGPXBPC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|