C17H27ClN3O+ — CID 7678438
N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-methylbutanamide (PubChem CID 7678438) has the molecular formula C17H27ClN3O+ and a molecular weight of 324.88 g/mol. Its IUPAC name is N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-methylbutanamide.
| Compound Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 7678438 |
| Molecular Formula | C17H27ClN3O+ |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-methylbutanamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)CC(C)C)cc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClN3O/c1-4-20-7-9-21(10-8-20)16-6-5-14(12-15(16)18)19-17(22)11-13(2)3/h5-6,12-13H,4,7-11H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | KSMLUAGQYZZZAS-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|