C17H21ClN3O2+ — CID 6957201
N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]furan-2-carboxamide (PubChem CID 6957201) has the molecular formula C17H21ClN3O2+ and a molecular weight of 334.83 g/mol. Its IUPAC name is N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 6957201 |
| Molecular Formula | C17H21ClN3O2+ |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[3-chloro-4-(4-ethylpiperazin-4-ium-1-yl)phenyl]furan-2-carboxamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3ccco3)cc2Cl)CC1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-2-20-7-9-21(10-8-20)15-6-5-13(12-14(15)18)19-17(22)16-4-3-11-23-16/h3-6,11-12H,2,7-10H2,1H3,(H,19,22)/p+1 |
| InChIKey | ALGFHGCJNGAOGX-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 49.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|