C22H18Cl3N3O3 — CID 17118164
3,4-dichloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17118164) has the molecular formula C22H18Cl3N3O3 and a molecular weight of 478.76 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17118164 |
| Molecular Formula | C22H18Cl3N3O3 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 3,4-dichloro-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl3N3O3/c23-16-5-3-14(12-17(16)24)21(29)26-15-4-6-19(18(25)13-15)27-7-9-28(10-8-27)22(30)20-2-1-11-31-20/h1-6,11-13H,7-10H2,(H,26,29) |
| InChIKey | VHPDCASQEDBWGG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|