C19H23ClN3O2+ — CID 7379395
N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-methoxybenzamide (PubChem CID 7379395) has the molecular formula C19H23ClN3O2+ and a molecular weight of 360.87 g/mol. Its IUPAC name is N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-methoxybenzamide.
| Compound Name | N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 7379395 |
| Molecular Formula | C19H23ClN3O2+ |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CC[NH+](C)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-22-8-10-23(11-9-22)18-7-6-15(13-17(18)20)21-19(24)14-4-3-5-16(12-14)25-2/h3-7,12-13H,8-11H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | LCOIONXIAUJRJK-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|