C20H22ClF3N3O+ — CID 7491939
N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 7491939) has the molecular formula C20H22ClF3N3O+ and a molecular weight of 412.86 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 7491939 |
| Molecular Formula | C20H22ClF3N3O+ |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC[NH+]1CCN(c2ccc(Cl)cc2NC(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H21ClF3N3O/c1-2-26-8-10-27(11-9-26)18-7-6-16(21)13-17(18)25-19(28)14-4-3-5-15(12-14)20(22,23)24/h3-7,12-13H,2,8-11H2,1H3,(H,25,28)/p+1 |
| InChIKey | KYEJMJQTTVCCRY-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |