C14H19F3N3O+ — CID 7165092
4-ethyl-N-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-carboxamide (PubChem CID 7165092) has the molecular formula C14H19F3N3O+ and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-ethyl-N-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-carboxamide.
| Compound Name | 4-ethyl-N-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7165092 |
| Molecular Formula | C14H19F3N3O+ |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-ethyl-N-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-carboxamide |
| SMILES | CC[NH+]1CCN(C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H18F3N3O/c1-2-19-6-8-20(9-7-19)13(21)18-12-5-3-4-11(10-12)14(15,16)17/h3-5,10H,2,6-9H2,1H3,(H,18,21)/p+1 |
| InChIKey | MNZOYOIUZVPTBY-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |