C15H20F3N3O3 — CID 23140293
3-[bis(2-hydroxyethyl)amino]-N-[3-(trifluoromethyl)phenyl]azetidine-1-carboxamide (PubChem CID 23140293) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)amino]-N-[3-(trifluoromethyl)phenyl]azetidine-1-carboxamide.
| Compound Name | 3-[bis(2-hydroxyethyl)amino]-N-[3-(trifluoromethyl)phenyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 23140293 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-[bis(2-hydroxyethyl)amino]-N-[3-(trifluoromethyl)phenyl]azetidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N1CC(N(CCO)CCO)C1 |
| InChI | InChI=1S/C15H20F3N3O3/c16-15(17,18)11-2-1-3-12(8-11)19-14(24)21-9-13(10-21)20(4-6-22)5-7-23/h1-3,8,13,22-23H,4-7,9-10H2,(H,19,24) |
| InChIKey | NGBNEVWZJLKQLV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |