C15H19F3N2O2S — CID 122150164
1-(2-hydroxyethyl)-1-(thian-4-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 122150164) has the molecular formula C15H19F3N2O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-(thian-4-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-hydroxyethyl)-1-(thian-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 122150164 |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-(thian-4-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N(CCO)C1CCSCC1 |
| InChI | InChI=1S/C15H19F3N2O2S/c16-15(17,18)11-2-1-3-12(10-11)19-14(22)20(6-7-21)13-4-8-23-9-5-13/h1-3,10,13,21H,4-9H2,(H,19,22) |
| InChIKey | GKGVISFJHUDMHR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |